ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
DL-threo-3-Phenylserine hydrate |
|
termék neve | DL-threo-3-Phenylserine hydrate |
Angol név | DL-threo-3-Phenylserine hydrate;3-Phenylserine monohydrate;DL-?-Phenylserine threoform DL-Threo-?-phenylserine;β-hydroxyphenylalanine hydrate (1:1);Dl-Beta-Phenylserine Threo Form |
MF | C9H13NO4 |
Molekulatömeg | 199.2038 |
InChI | InChI=1/C9H11NO3.H2O/c10-7(9(12)13)8(11)6-4-2-1-3-5-6;/h1-5,7-8,11H,10H2,(H,12,13);1H2 |
CAS-szám | 69-96-5 |
EINECS | 200-721-2 |
Molekuláris szerkezete | |
Olvadáspont | 186℃ |
Forráspont | 483.1°C at 760 mmHg |
Gyulladáspont | 246°C |
Gőznyomás | 3.8E-10mmHg at 25°C |
Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
MSDS |