ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
636-70-4 Triethylamine hydrobromide |
|
termék neve | Triethylamine hydrobromide |
Angol név | Triethylamine hydrobromide;triethylammonium bromide |
MF | C6H15N.HBr |
Molekulatömeg | 182.10 |
InChI | InChI=1/C6H15N.BrH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H |
CAS-szám | 636-70-4 |
EINECS | 211-263-8 |
Molekuláris szerkezete | |
Olvadáspont | 246-248℃ |
Veszély szimbólumok | Xi##Irritant:; |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |