ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Benzoyl bromide |
|
termék neve | Benzoyl bromide |
Angol név | Benzoyl bromide; |
MF | C7H5BrO |
Molekulatömeg | 185.018 |
InChI | InChI=1/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
CAS-szám | 618-32-6 |
EINECS | 210-544-2 |
Molekuláris szerkezete | |
Sűrűség | 1.572g/cm3 |
Olvadáspont | -24℃ |
Forráspont | 218.5°C at 760 mmHg |
Törésmutató | 1.584 |
Gyulladáspont | 89.7°C |
Gőznyomás | 0.125mmHg at 25°C |
Veszély szimbólumok | C##Corrosive:; |
Kockázatot kódok | R34##Causes burns.:; |
Biztonsági Leírás | S25##Avoid contact with eyes.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |