ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
615-94-1 2,5-Dihydroxy-1,4-benzoquinone |
|
termék neve | 2,5-Dihydroxy-1,4-benzoquinone |
Angol név | 2,5-Dihydroxy-1,4-benzoquinone;2,5-Dihydroxybenzoquinone;2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
MF | C6H4O4 |
Molekulatömeg | 140.0936 |
InChI | InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
CAS-szám | 615-94-1 |
EINECS | 210-454-3 |
Molekuláris szerkezete | |
Sűrűség | 1.843g/cm3 |
Olvadáspont | 220℃ |
Forráspont | 322.3°C at 760 mmHg |
Törésmutató | 1.729 |
Gyulladáspont | 162.9°C |
Gőznyomás | 2.24E-05mmHg at 25°C |
Veszély szimbólumok | Xn##Harmful:; |
Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Biztonsági Leírás | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |