ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
615-74-7 2-Chloro-5-methylphenol |
|
termék neve | 2-Chloro-5-methylphenol |
Angol név | 2-Chloro-5-methylphenol;4-Chloro-3-hydroxytoluene; 6-chloro-m-cresol |
MF | C7H7ClO |
Molekulatömeg | 142.58 |
InChI | InChI=1/C7H7ClO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,1H3 |
CAS-szám | 615-74-7 |
EINECS | 210-444-9 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.215 |
Olvadáspont | 45-48℃ |
Forráspont | 196℃ |
Gyulladáspont | 81℃ |
Veszély szimbólumok | |
Kockázatot kódok | R21/22##Harmful in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |