ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Cinnamylideneacetophenone |
|
termék neve | Cinnamylideneacetophenone |
Angol név | Cinnamylideneacetophenone;5-phenylpenta-2,4-dienophenone;1,5-Diphenyl-2,4-pentadien-1-one~5-Phenyl-2,4-pentadienophenone;1,5-diphenylpenta-2,4-dien-1-one;(2E,4E)-1,5-diphenylpenta-2,4-dien-1-one |
MF | C17H14O |
Molekulatömeg | 234.2925 |
InChI | InChI=1/C17H14O/c18-17(16-12-5-2-6-13-16)14-8-7-11-15-9-3-1-4-10-15/h1-14H/b11-7+,14-8+ |
CAS-szám | 614-57-3 |
EINECS | 210-385-9 |
Molekuláris szerkezete | |
Sűrűség | 1.082g/cm3 |
Olvadáspont | 100-102℃ |
Forráspont | 388.1°C at 760 mmHg |
Törésmutató | 1.624 |
Gyulladáspont | 169.6°C |
Gőznyomás | 3.15E-06mmHg at 25°C |
Biztonsági Leírás | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |