ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
N'-hydroxybenzenecarboximidamide |
|
termék neve | N'-hydroxybenzenecarboximidamide |
Angol név | N'-hydroxybenzenecarboximidamide;Benzamidoxime;N-Hydroxy-Benzamidine |
MF | C7H8N2O |
Molekulatömeg | 136.1512 |
InChI | InChI=1/C7H8N2O/c8-7(9-10)6-4-2-1-3-5-6/h1-5,10H,(H2,8,9) |
CAS-szám | 613-92-3 |
EINECS | 210-361-8 |
Molekuláris szerkezete | |
Sűrűség | 1.18g/cm3 |
Olvadáspont | 60℃ |
Forráspont | 307.4°C at 760 mmHg |
Törésmutató | 1.574 |
Gyulladáspont | 139.7°C |
Gőznyomás | 0.000315mmHg at 25°C |
Veszély szimbólumok | Xn##Harmful:; |
Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |