ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-methylquinolin-6-ol |
|
termék neve | 2-methylquinolin-6-ol |
Angol név | 2-methylquinolin-6-ol;6-Hydroxy-2-methylquinoline;2-Methyl-6-hydroxyquinoline;2-Methyl-6-hydroxyquinoine |
MF | C10H9NO |
Molekulatömeg | 159.1846 |
InChI | InChI=1/C10H9NO/c1-7-2-3-8-6-9(12)4-5-10(8)11-7/h2-6,12H,1H3 |
CAS-szám | 613-21-8 |
Molekuláris szerkezete | |
Sűrűség | 1.21g/cm3 |
Olvadáspont | 198℃ |
Forráspont | 304.5°C at 760 mmHg |
Törésmutató | 1.666 |
Gyulladáspont | 142.3°C |
Gőznyomás | 0.000483mmHg at 25°C |
Veszély szimbólumok | Xi##Irritant:; |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |