ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Aminoanthracene |
|
termék neve | 2-Aminoanthracene |
Angol név | 2-Aminoanthracene;2-anthramine practical grade*crystalline;2-anthrylamine;2-Anthramine;2-Anthranamine;anthracen-2-amine;2-Anthracenamide; |
MF | C14H11N |
Molekulatömeg | 193.2438 |
InChI | InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
CAS-szám | 613-13-8 |
EINECS | 210-330-9 |
Molekuláris szerkezete | |
Sűrűség | 1.208g/cm3 |
Olvadáspont | 238-241℃ |
Forráspont | 414.2°C at 760 mmHg |
Törésmutató | 1.765 |
Gyulladáspont | 229°C |
Gőznyomás | 4.52E-07mmHg at 25°C |
Veszély szimbólumok | Xn##Harmful:; |
Kockázatot kódok | R33##Danger of cummulative effects.:; |
Biztonsági Leírás | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |