ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,2,4-Triacetoxybenzene |
|
termék neve | 1,2,4-Triacetoxybenzene |
Angol név | 1,2,4-Triacetoxybenzene;1,2,4-Phenenyl triacetate;benzene-1,2,4-triyl triacetate;2-[(1-hydroxyethenyl)oxy]benzene-1,4-diyl diacetate |
MF | C12H12O6 |
Molekulatömeg | 252.2201 |
InChI | InChI=1/C12H12O6/c1-7(13)16-10-4-5-11(17-8(2)14)12(6-10)18-9(3)15/h4-6,15H,3H2,1-2H3 |
CAS-szám | 613-03-6 |
EINECS | 210-327-2 |
Molekuláris szerkezete | |
Sűrűség | 1.276g/cm3 |
Olvadáspont | 98-100℃ |
Forráspont | 401°C at 760 mmHg |
Törésmutató | 1.533 |
Gyulladáspont | 153.2°C |
Gőznyomás | 3.77E-07mmHg at 25°C |
Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
MSDS |