ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
612-23-7 2-Nitrobenzyl chloride |
|
termék neve | 2-Nitrobenzyl chloride |
Angol név | 2-Nitrobenzyl chloride;alpha-Chloro-2-nitrotoluene;a-Chloro-2-nitrotoluene);1-chloro-2-methyl-3-nitrobenzene;1-(chloromethyl)-2-nitrobenzene |
MF | C7H6ClNO2 |
Molekulatömeg | 171.581 |
InChI | InChI=1/C7H6ClNO2/c8-5-6-3-1-2-4-7(6)9(10)11/h1-4H,5H2 |
CAS-szám | 612-23-7 |
EINECS | 210-300-5 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.33g/cm3 |
Olvadáspont | 46-50℃ |
Forráspont | 269°C at 760 mmHg |
Törésmutató | 1.574 |
Gyulladáspont | 112.7°C |
Gőznyomás | 0.0123mmHg at 25°C |
Veszély szimbólumok | |
Kockázatot kódok | R34##Causes burns.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |