ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3,3'-Diaminobenzophenone |
|
termék neve | 3,3'-Diaminobenzophenone |
Angol név | 3,3'-Diaminobenzophenone;bis(3-aminophenyl)methanone |
MF | C13H12N2O |
Molekulatömeg | 212.2472 |
InChI | InChI=1/C13H12N2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H,14-15H2 |
CAS-szám | 611-79-0 |
EINECS | 210-281-3 |
Molekuláris szerkezete | |
Sűrűség | 1.233g/cm3 |
Forráspont | 469.4°C at 760 mmHg |
Törésmutató | 1.673 |
Gyulladáspont | 237.7°C |
Gőznyomás | 5.51E-09mmHg at 25°C |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |