ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Iodo-m-xylene |
|
termék neve | 2-Iodo-m-xylene |
Angol név | 2-Iodo-m-xylene;2-Iodo-1,3-Dimethylbenzene |
MF | C8H9I |
Molekulatömeg | 232.0615 |
InChI | InChI=1/C8H9I/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
CAS-szám | 608-28-6 |
EINECS | 210-158-4 |
Molekuláris szerkezete | |
Sűrűség | 1.61g/cm3 |
Forráspont | 227.5°C at 760 mmHg |
Törésmutató | 1.592 |
Gyulladáspont | 98.1°C |
Vízben való oldhatóság | insoluble |
Gőznyomás | 0.116mmHg at 25°C |
Veszély szimbólumok | Xi##Irritant:; |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection:; |
MSDS |