ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
606-43-9 N-Methylcarbostyril |
|
termék neve | N-Methylcarbostyril |
Angol név | N-Methylcarbostyril;2-Hydroxy-1-methylquinoline;N-Methylcarbostyril;1-methylquinolin-2(1H)-one;1-methyl-2-Quinolinone |
MF | C10H9NO |
Molekulatömeg | 159.1846 |
InChI | InChI=1/C10H9NO/c1-11-9-5-3-2-4-8(9)6-7-10(11)12/h2-7H,1H3 |
CAS-szám | 606-43-9 |
Molekuláris szerkezete | |
Sűrűség | 1.16g/cm3 |
Forráspont | 247.5°C at 760 mmHg |
Törésmutató | 1.592 |
Gyulladáspont | 106.8°C |
Gőznyomás | 0.0255mmHg at 25°C |
Biztonsági Leírás | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |