ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
603-10-1 2,3,6-trinitrophenol moistened with water (H2O ~40%) |
|
termék neve | 2,3,6-trinitrophenol moistened with water (H2O ~40%) |
Angol név | 2,3,6-trinitrophenol moistened with water (H2O ~40%); |
MF | C6H3N3O7 |
Molekulatömeg | 229.1039 |
InChI | InChI=1/C6H3N3O7/c10-6-4(8(13)14)2-1-3(7(11)12)5(6)9(15)16/h1-2,10H |
CAS-szám | 603-10-1 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.856g/cm3 |
Olvadáspont | 119-120℃ |
Forráspont | 337.9°C at 760 mmHg |
Törésmutató | 1.701 |
Gyulladáspont | 151.1°C |
Gőznyomás | 5.2E-05mmHg at 25°C |
MSDS |