Chemindex > 602-87-9
HU ▼
5-Nitroacenaphthene |
|
| termék neve | 5-Nitroacenaphthene |
| Angol név | 5-Nitroacenaphthene;1,2-Dihydro-5-nitro-acenaphthylene;4-05-00-01840 (Beilstein Handbook Reference);5-Nan;5-Nitroacenaphthylene;5-Nitroacenapthene;5-Nitronaphthalene;5-Nitronaphthalene ethylene;Acenaphthene, 5-nitro-;Acenaphthylene, 1,2-dihydro-5-nitro-;BRN 1876864;CCRIS 438;HSDB 4092;NCI-C01967;NSC 1312;NSC 22421;1,2-Dihydro-5-nitroacenaphthylene;5-nitro-1,2-dihydroacenaphthylene;Nitroacenaphthene;1,2-dihydro-5-nitro-acenaphthylen |
| MF | C12H7NO2 |
| Molekulatömeg | 197.1895 |
| InChI | InChI=1/C12H7NO2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7H |
| CAS-szám | 602-87-9 |
| EINECS | 210-025-0 |
| Molekuláris szerkezete |  |
| Sűrűség | 1.408g/cm3 |
| Olvadáspont | 101-102℃ |
| Forráspont | 381.6°C at 760 mmHg |
| Törésmutató | 1.763 |
| Gyulladáspont | 196.7°C |
| Gőznyomás | 1.1E-05mmHg at 25°C |
| Kockázatot kódok | R45##May cause cancer.:; |
| Biztonsági Leírás | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
| MSDS | |
-
Ha azt tervezi, hogy vegyi anyagokat szerez be Kínából, csak menjen a ChemNet bevásárlóközpontba, mi megkapjuk a legújabb és versenyképes árat a kínai gyártóktól az Ön számára.Kérjük, látogasson el a
ChemNet Mall
oldalra.
A kémiai CAS adatbázis szolgáltatást a ChemIndex.com nyújtja 