Chemindex > 57878-93-0
HU ▼
57878-93-0 2-chloro-4-methylphenyl isothiocyanate |
|
| termék neve | 2-chloro-4-methylphenyl isothiocyanate |
| Angol név | 2-chloro-4-methylphenyl isothiocyanate;2-Chloro-4-methylphenyl isothiocyanate;2-chloro-1-isothiocyanato-4-methylbenzene |
| MF | C8H6ClNS |
| Molekulatömeg | 183.6579 |
| InChI | InChI=1/C8H6ClNS/c1-6-2-3-8(10-5-11)7(9)4-6/h2-4H,1H3 |
| CAS-szám | 57878-93-0 |
| Molekuláris szerkezete |  |
| Sűrűség | 1.18g/cm3 |
| Forráspont | 286.8°C at 760 mmHg |
| Törésmutató | 1.583 |
| Gyulladáspont | 127.3°C |
| Gőznyomás | 0.00444mmHg at 25°C |
| Veszély szimbólumok |  Xn##Harmful:; |
| Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
-
Ha azt tervezi, hogy vegyi anyagokat szerez be Kínából, csak menjen a ChemNet bevásárlóközpontba, mi megkapjuk a legújabb és versenyképes árat a kínai gyártóktól az Ön számára.Kérjük, látogasson el a
ChemNet Mall
oldalra.
Beszállítók 57878-93-0 (0) -ért:
A kémiai CAS adatbázis szolgáltatást a ChemIndex.com nyújtja 