ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Acetamidofluorene |
|
termék neve | 2-Acetamidofluorene |
Angol név | 2-Acetamidofluorene;N-(2-Fluorenyl)acetamide;Acetamidofluorene;N-(9H-fluoren-2-yl)acetamide;2-(9H-fluoren-2-yl)acetamide |
MF | C15H13NO |
Molekulatömeg | 223.2698 |
InChI | InChI=1/C15H13NO/c16-15(17)8-10-5-6-14-12(7-10)9-11-3-1-2-4-13(11)14/h1-7H,8-9H2,(H2,16,17) |
CAS-szám | 53-96-3 |
EINECS | 200-188-6 |
Molekuláris szerkezete | |
Sűrűség | 1.227g/cm3 |
Olvadáspont | 192-196℃ |
Forráspont | 471.2°C at 760 mmHg |
Törésmutató | 1.656 |
Gyulladáspont | 238.8°C |
Vízben való oldhatóság | 0.000529 g/100 mL |
Gőznyomás | 4.73E-09mmHg at 25°C |
Veszély szimbólumok | T##Toxic:; |
Kockázatot kódok | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R46##May cause heritable genetic damages.:; |
Biztonsági Leírás | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |