ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-92-8 tetraiodoethylene |
|
termék neve | tetraiodoethylene |
Angol név | tetraiodoethylene;diiodoform;tetraiodoethene |
MF | C2I4 |
Molekulatömeg | 531.6393 |
InChI | InChI=1/C2I4/c3-1(4)2(5)6 |
CAS-szám | 513-92-8 |
EINECS | 208-176-2 |
Molekuláris szerkezete | |
Sűrűség | 4.087g/cm3 |
Olvadáspont | 191-193℃ |
Forráspont | 288.3°C at 760 mmHg |
Törésmutató | 1.952 |
Gyulladáspont | 139.9°C |
Gőznyomás | 0.00409mmHg at 25°C |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |