Chemindex > 50529-33-4
HU ▼
50529-33-4 3-chloro-4-(fluorophenyl)isocyanate |
|
| termék neve | 3-chloro-4-(fluorophenyl)isocyanate |
| Angol név | 3-chloro-4-(fluorophenyl)isocyanate;3-Chloro-4-fluorophenyl isocyanate;2-chloro-1-fluoro-4-isocyanatobenzene |
| MF | C7H3ClFNO |
| Molekulatömeg | 171.5562 |
| InChI | InChI=1/C7H3ClFNO/c8-6-3-5(10-4-11)1-2-7(6)9/h1-3H |
| CAS-szám | 50529-33-4 |
| Molekuláris szerkezete |  |
| Sűrűség | 1.31g/cm3 |
| Forráspont | 228.7°C at 760 mmHg |
| Törésmutató | 1.533 |
| Gyulladáspont | 92.1°C |
| Gőznyomás | 0.0723mmHg at 25°C |
| Veszély szimbólumok |  Xn##Harmful:; |
| Kockázatot kódok | R23/25##Toxic by inhalation and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.||R42##May cause sensitization by inhalation.:; |
| Biztonsági Leírás | S23##Do not inhale gas/fumes/vapour/spray.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
-
Ha azt tervezi, hogy vegyi anyagokat szerez be Kínából, csak menjen a ChemNet bevásárlóközpontba, mi megkapjuk a legújabb és versenyképes árat a kínai gyártóktól az Ön számára.Kérjük, látogasson el a
ChemNet Mall
oldalra.
A kémiai CAS adatbázis szolgáltatást a ChemIndex.com nyújtja 