ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
505-54-4 Hexadecanedioic acid |
|
termék neve | Hexadecanedioic acid |
Angol név | Hexadecanedioic acid;Thapsic acid;1,16-Hexadecanedioic acid;Hexadecane Diacid;hexadecanedioate |
MF | C16H28O4 |
Molekulatömeg | 284.3922 |
InChI | InChI=1/C16H30O4/c17-15(18)13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(19)20/h1-14H2,(H,17,18)(H,19,20)/p-2 |
CAS-szám | 505-54-4 |
EINECS | 208-013-5 |
Molekuláris szerkezete | |
Olvadáspont | 120-123℃ |
Forráspont | 457.5°C at 760 mmHg |
Gyulladáspont | 244.6°C |
Gőznyomás | 1.22E-09mmHg at 25°C |
Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
MSDS |