ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
phorone |
|
termék neve | phorone |
Angol név | phorone;2,6-Dimethyl-2,5-heptadien-4-one;Diisopropyllideneacetone;2,6-dimethylhepta-2,5-dien-4-one |
MF | C9H14O |
Molekulatömeg | 138.2069 |
InChI | InChI=1/C9H14O/c1-7(2)5-9(10)6-8(3)4/h5-6H,1-4H3 |
CAS-szám | 504-20-1 |
EINECS | 207-986-3 |
Molekuláris szerkezete | |
Sűrűség | 0.858g/cm3 |
Olvadáspont | 23-26℃ |
Forráspont | 198.5°C at 760 mmHg |
Törésmutató | 1.453 |
Gyulladáspont | 79.4°C |
Gőznyomás | 0.358mmHg at 25°C |
Biztonsági Leírás | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |