ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,4-Diamino-s-triazin |
|
termék neve | 2,4-Diamino-s-triazin |
Szinonimák | ;D iaminotriazin; 1,3,5-triazin-2,4-diamin; 2,4-diamino-1,3,5-triazin; |
Angol név | 2,4-Diamino-s-triazine;Diaminotriazine;1,3,5-triazine-2,4-diamine;2,4-Diamino-1,3,5-Triazine |
MF | C3H5N5 |
Molekulatömeg | 111.1053 |
InChI | InChI=1/C3H5N5/c4-2-6-1-7-3(5)8-2/h1H,(H4,4,5,6,7,8) |
CAS-szám | 504-08-5 |
EINECS | 207-983-7 |
Molekuláris szerkezete | |
Sűrűség | 1.508g/cm3 |
Forráspont | 447.6°C at 760 mmHg |
Törésmutató | 1.716 |
Gyulladáspont | 254.9°C |
Gőznyomás | 3.32E-08mmHg at 25°C |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |