ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
6-(Methylthio)purine |
|
termék neve | 6-(Methylthio)purine |
Angol név | 6-(Methylthio)purine;6-(Methylmercapto)purine;6-(Methylsulfanyl)-9H-purine;6-(methylsulfanyl)-7H-purine;6-(methylsulfanyl)-5H-purine |
MF | C6H6N4S |
Molekulatömeg | 166.2036 |
InChI | InChI=1/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-4H,1H3 |
CAS-szám | 50-66-8 |
EINECS | 200-057-3 |
Molekuláris szerkezete | |
Sűrűség | 1.59g/cm3 |
Olvadáspont | 221-222℃ |
Forráspont | 290.9°C at 760 mmHg |
Törésmutató | 1.806 |
Gyulladáspont | 129.7°C |
Gőznyomás | 0.00351mmHg at 25°C |
Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
MSDS |