ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1-(3-fluorophenyl)-2-thiourea |
|
termék neve | 1-(3-fluorophenyl)-2-thiourea |
Angol név | 1-(3-fluorophenyl)-2-thiourea;3-Fluorophenylthiourea;1-(3-fluorophenyl)thiourea |
MF | C7H7FN2S |
Molekulatömeg | 170.2073 |
InChI | InChI=1/C7H7FN2S/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,(H3,9,10,11) |
CAS-szám | 458-05-9 |
Molekuláris szerkezete | |
Sűrűség | 1.397g/cm3 |
Forráspont | 259.3°C at 760 mmHg |
Törésmutató | 1.692 |
Gyulladáspont | 110.6°C |
Gőznyomás | 0.0131mmHg at 25°C |
Kockázatot kódok | R25##Toxic if swallowed.:; |
Biztonsági Leírás | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |