ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
DL-Homocysteine |
|
termék neve | DL-Homocysteine |
Angol név | DL-Homocysteine;DL-Homocysteine 2-Amino-4-mercaptobuyric acid;homocysteine;D-homocysteine |
MF | C4H9NO2S |
Molekulatömeg | 135.1848 |
InChI | InChI=1/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m1/s1 |
CAS-szám | 454-29-5 |
EINECS | 207-222-9 |
Molekuláris szerkezete | |
Sűrűség | 1.259g/cm3 |
Olvadáspont | 232-233℃ |
Forráspont | 299.7°C at 760 mmHg |
Törésmutató | 1.537 |
Gyulladáspont | 135°C |
Gőznyomás | 0.000278mmHg at 25°C |
Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
MSDS |