ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Fluoro-5-Iodotoluene |
|
termék neve | 2-Fluoro-5-Iodotoluene |
Angol név | 2-Fluoro-5-Iodotoluene; |
MF | C7H6FI |
Molekulatömeg | 236.02 |
InChI | InChI=1/C7H6FI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
CAS-szám | 452-68-6 |
EINECS | 207-206-1 |
Molekuláris szerkezete | |
Kockázatot kódok | R36/38##Irritating to eyes and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |