ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
40851-62-5 Methyl o-tolylacetate |
|
termék neve | Methyl o-tolylacetate |
Angol név | Methyl o-tolylacetate;Methyl 2-methylphenylacetate |
MF | C10H12O2 |
Molekulatömeg | 164.2011 |
InChI | InChI=1/C10H12O2/c1-8-5-3-4-6-9(8)7-10(11)12-2/h3-6H,7H2,1-2H3 |
CAS-szám | 40851-62-5 |
Molekuláris szerkezete | |
Sűrűség | 1.035g/cm3 |
Forráspont | 229.8°C at 760 mmHg |
Törésmutató | 1.505 |
Gyulladáspont | 101.9°C |
Gőznyomás | 0.068mmHg at 25°C |
Biztonsági Leírás | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |