ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
ethylchlorofluoroacetate |
|
termék neve | ethylchlorofluoroacetate |
Angol név | ethylchlorofluoroacetate;Ethyl chlorofluoroacetate;Chlorofluoroacetic acid ethyl ester;ethyl (2S)-chloro(fluoro)ethanoate;ethyl (2R)-chloro(fluoro)ethanoate |
MF | C4H6ClFO2 |
Molekulatömeg | 140.5406 |
InChI | InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
CAS-szám | 401-56-9 |
EINECS | 206-930-5 |
Molekuláris szerkezete | |
Sűrűség | 1.219g/cm3 |
Forráspont | 129°C at 760 mmHg |
Törésmutató | 1.39 |
Gyulladáspont | 44.3°C |
Gőznyomás | 10.4mmHg at 25°C |
Veszély szimbólumok | C##Corrosive:; |
Kockázatot kódok | R34##Causes burns.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |