ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4004-95-9 1-fenilpiperazin-dihidroklorid |
|
termék neve | 1-fenilpiperazin-dihidroklorid |
Szinonimák | 1-fenilpiperazin-dihidroklorid; 1-fenilpiperazin-HCl |
Angol név | 1-phenylpiperazine dihydrochloride;1-Phenylpiperazine dihydrochloride;1-Phenylpiperazine HCl |
MF | C10H16Cl2N2 |
Molekulatömeg | 235.1534 |
InChI | InChI=1/C10H14N2.2ClH/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;;/h1-5,11H,6-9H2;2*1H |
CAS-szám | 4004-95-9 |
EINECS | 223-654-0 |
Molekuláris szerkezete | |
Forráspont | 287.2°C at 760 mmHg |
Gyulladáspont | 138.3°C |
Gőznyomás | 0.00252mmHg at 25°C |
Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |