ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
388088-83-3 2-bróm-1-(3,5-dimetil-1-benzotiofén-2-il)-1-etanon |
|
termék neve | 2-bróm-1-(3,5-dimetil-1-benzotiofén-2-il)-1-etanon |
Szinonimák | 2-bróm-1-(3,5-dimetil-1-benzotiofén-2-il)etanon; |
Angol név | 2-bromo-1-(3,5-dimethyl-1-benzothiophen-2-yl)-1-ethanone;2-bromo-1-(3,5-dimethyl-1-benzothiophen-2-yl)ethanone |
MF | C12H11BrOS |
Molekulatömeg | 283.1841 |
InChI | InChI=1/C12H11BrOS/c1-7-3-4-11-9(5-7)8(2)12(15-11)10(14)6-13/h3-5H,6H2,1-2H3 |
CAS-szám | 388088-83-3 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.488g/cm3 |
Olvadáspont | 125℃ |
Forráspont | 378.5°C at 760 mmHg |
Törésmutató | 1.655 |
Gyulladáspont | 182.7°C |
Gőznyomás | 6.26E-06mmHg at 25°C |
Veszély szimbólumok | |
Kockázatot kódok | R34##Causes burns.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |