ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
37619-24-2 Methyl 1-methylpyrrole-2-carboxylate |
|
termék neve | Methyl 1-methylpyrrole-2-carboxylate |
Angol név | Methyl 1-methylpyrrole-2-carboxylate;1-Methylpyrrole-2-carboxylic acid methyl ester;methyl 1-methyl-1H-pyrrole-2-carboxylate |
MF | C7H9NO2 |
Molekulatömeg | 139.1519 |
InChI | InChI=1/C7H9NO2/c1-8-5-3-4-6(8)7(9)10-2/h3-5H,1-2H3 |
CAS-szám | 37619-24-2 |
Molekuláris szerkezete | |
Sűrűség | 1.07g/cm3 |
Forráspont | 204.7°C at 760 mmHg |
Törésmutató | 1.5 |
Gyulladáspont | 77.6°C |
Gőznyomás | 0.26mmHg at 25°C |
Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
MSDS |