ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
343-27-1 Harmine hydrochloride hydrate |
|
termék neve | Harmine hydrochloride hydrate |
Angol név | Harmine hydrochloride hydrate;7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole hydrochloride hydrate;Harmine hydrochlorid;Banisterine, Telepathine;7-methoxy-1-methyl-9H-beta-carbolin-9-ium chloride;Harmine Hydrochloride |
MF | C13H13ClN2O |
Molekulatömeg | 248.7081 |
InChI | InChI=1/C13H12N2O.ClH/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;/h3-7,15H,1-2H3;1H |
CAS-szám | 343-27-1 |
EINECS | 206-443-8 |
Molekuláris szerkezete | ![]() |
Olvadáspont | 265-270℃ |
Forráspont | 421.4°C at 760 mmHg |
Gyulladáspont | 139.8°C |
Gőznyomás | 6.42E-07mmHg at 25°C |
Veszély szimbólumok | |
Kockázatot kódok | R40##Possible risks of irreversible effects.:; |
Biztonsági Leírás | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |