ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Orphenadrine hydrochloride |
|
termék neve | Orphenadrine hydrochloride |
Angol név | Orphenadrine hydrochloride;N,N-Dimethyl-2-(o-methyl-alpha-phenylbenzyloxy)-ethylamine hydrochloride;N,N-dimethyl-2-[(2-methylphenyl)(phenyl)methoxy]ethanamine hydrochloride (1:1);N,N-dimethyl-2-[(R)-(2-methylphenyl)(phenyl)methoxy]ethanaminium;N,N-dimethyl-2-[(S)-(2-methylphenyl)(phenyl)methoxy]ethanaminium |
MF | C18H24NO |
Molekulatömeg | 270.3887 |
InChI | InChI=1/C18H23NO/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16/h4-12,18H,13-14H2,1-3H3/p+1/t18-/m0/s1 |
CAS-szám | 341-69-5 |
EINECS | 206-435-4 |
Molekuláris szerkezete | |
Olvadáspont | 159-162℃ |
Forráspont | 363°C at 760 mmHg |
Gyulladáspont | 107.1°C |
Gőznyomás | 1.86E-05mmHg at 25°C |
Veszély szimbólumok | Xn##Harmful:; |
Kockázatot kódok | R20/21##Harmful by inhalation and in contact with skin.:; |
Biztonsági Leírás | S23##Do not inhale gas/fumes/vapour/spray.:; |
MSDS |