ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
331-62-4 3-fluoro-4-methoxybenzonitrile |
|
termék neve | 3-fluoro-4-methoxybenzonitrile |
Angol név | 3-fluoro-4-methoxybenzonitrile;Fluoromethoxybenzonitrile |
MF | C8H6FNO |
Molekulatömeg | 151.1377 |
InChI | InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
CAS-szám | 331-62-4 |
Molekuláris szerkezete | |
Sűrűség | 1.18g/cm3 |
Forráspont | 254.3°C at 760 mmHg |
Törésmutató | 1.505 |
Gyulladáspont | 107.6°C |
Gőznyomás | 0.0173mmHg at 25°C |
Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Biztonsági Leírás | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |