ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306-37-6 sym-Dimethylhydrazine dihydrochloride |
|
termék neve | sym-Dimethylhydrazine dihydrochloride |
Angol név | sym-Dimethylhydrazine dihydrochloride;1,2-Dimethylhydrazine dihydrochloride;1,2-dimethylhydrazine;1,1-dimethylhydrazine dihydrochloride |
MF | C2H10Cl2N2 |
Molekulatömeg | 133.0202 |
InChI | InChI=1/C2H8N2.2ClH/c1-4(2)3;;/h3H2,1-2H3;2*1H |
CAS-szám | 306-37-6 |
EINECS | 206-183-5 |
Molekuláris szerkezete | |
Olvadáspont | 166-167℃ |
Forráspont | 63.9°C at 760 mmHg |
Gyulladáspont | 1.1°C |
Gőznyomás | 168mmHg at 25°C |
Veszély szimbólumok | T##Toxic:; |
Kockázatot kódok | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R45##May cause cancer.:; |
Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
MSDS |