ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,5-Dichlorophenylhydrazine |
|
termék neve | 2,5-Dichlorophenylhydrazine |
Angol név | 2,5-Dichlorophenylhydrazine ;-2,5-DICHLOROPHENYLHYDRAZINE;1-(2,5-DICHLOROPHENYL)HYDRAZINE;(2,5-dichlorophenyl)-hydrazin;Hydrazine, (2,5-dichlorophenyl)-;2,5-DICHLOROPHENYLHYRAZINE |
MF | C6H6Cl2N2 |
Molekulatömeg | 177.0312 |
InChI | InChI=1/C6H6Cl2N2/c7-4-1-2-5(8)6(3-4)10-9/h1-3,10H,9H2 |
CAS-szám | 305-15-7 |
EINECS | 206-163-6 |
Molekuláris szerkezete | |
Sűrűség | 1.475g/cm3 |
Olvadáspont | 100-104℃ |
Forráspont | 266.8°C at 760 mmHg |
Törésmutató | 1.665 |
Gyulladáspont | 115.1°C |
Gőznyomás | 0.00848mmHg at 25°C |
Veszély szimbólumok | Xi##Irritant:; |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |