ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
20850-43-5 5-(chloromethyl)-1,3-benzodioxole |
|
termék neve | 5-(chloromethyl)-1,3-benzodioxole |
Angol név | 5-(chloromethyl)-1,3-benzodioxole;3,4-Methylenedioxybenzyl chloride;5-chloro-1,3-benzodioxole;Piperonal chloride |
MF | C7H5ClO2 |
Molekulatömeg | 156.5664 |
InChI | InChI=1/C7H5ClO2/c8-5-1-2-6-7(3-5)10-4-9-6/h1-3H,4H2 |
CAS-szám | 20850-43-5 |
EINECS | 244-081-2 |
Molekuláris szerkezete | |
Sűrűség | 1.39g/cm3 |
Forráspont | 186°C at 760 mmHg |
Törésmutató | 1.577 |
Gyulladáspont | 93.9°C |
Gőznyomás | 0.931mmHg at 25°C |
Veszély szimbólumok | C##Corrosive:; |
Kockázatot kódok | R34##Causes burns.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |