ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
18781-31-2 2-Acetyl-3-methylbenzo[b]thiophene |
|
termék neve | 2-Acetyl-3-methylbenzo[b]thiophene |
Angol név | 2-Acetyl-3-methylbenzo[b]thiophene;2-Acetyl-3-methylthianaphthene;1-(3-Methylbenzo[b]thiophen-2-yl)ethan-1-one;1-(3-methyl-1-benzothiophen-6-yl)ethanone;1-(3-methyl-1-benzothiophen-2-yl)ethanone |
MF | C11H10OS |
Molekulatömeg | 190.2615 |
InChI | InChI=1/C11H10OS/c1-7-9-5-3-4-6-10(9)13-11(7)8(2)12/h3-6H,1-2H3 |
CAS-szám | 18781-31-2 |
Molekuláris szerkezete | |
Sűrűség | 1.182g/cm3 |
Olvadáspont | 79℃ |
Forráspont | 319.5°C at 760 mmHg |
Törésmutató | 1.631 |
Gyulladáspont | 147°C |
Gőznyomás | 0.000337mmHg at 25°C |
Biztonsági Leírás | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |