ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13103-75-8 4-(2-Pyridylazo)-N,N-dimethylaniline |
|
termék neve | 4-(2-Pyridylazo)-N,N-dimethylaniline |
Angol név | 4-(2-Pyridylazo)-N,N-dimethylaniline;N,N-Dimethyl-4-(2-pyridinylazo)-benzenamine;trans-Pyridine-2-azo-p-dimethylaniline;N,N-dimethyl-4-[(E)-pyridin-2-yldiazenyl]aniline |
MF | C13H14N4 |
Molekulatömeg | 226.2771 |
InChI | InChI=1/C13H14N4/c1-17(2)12-8-6-11(7-9-12)15-16-13-5-3-4-10-14-13/h3-10H,1-2H3/b16-15+ |
CAS-szám | 13103-75-8 |
EINECS | 236-026-6 |
Molekuláris szerkezete | |
Sűrűség | 1.08g/cm3 |
Olvadáspont | 108-112℃ |
Forráspont | 392.8°C at 760 mmHg |
Törésmutató | 1.588 |
Gyulladáspont | 191.4°C |
Gőznyomás | 2.22E-06mmHg at 25°C |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |