ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
decyl acetate |
|
termék neve | decyl acetate |
Angol név | decyl acetate;N-DECYL ACETATE |
MF | C12H24O2 |
Molekulatömeg | 200.3178 |
InChI | InChI=1/C12H24O2/c1-3-4-5-6-7-8-9-10-11-14-12(2)13/h3-11H2,1-2H3 |
CAS-szám | 112-17-4 |
EINECS | 203-942-2 |
Molekuláris szerkezete | |
Sűrűség | 0.87g/cm3 |
Forráspont | 244.1°C at 760 mmHg |
Törésmutató | 1.429 |
Gyulladáspont | 101.3°C |
Gőznyomás | 0.031mmHg at 25°C |
Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
MSDS |