ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Bromolauric acid |
|
termék neve | 2-Bromolauric acid |
Angol név | 2-Bromolauric acid;2-Bromododecanoic acid |
MF | C12H23BrO2 |
Molekulatömeg | 279.2138 |
InChI | InChI=1/C12H23BrO2/c1-2-3-4-5-6-7-8-9-10-11(13)12(14)15/h11H,2-10H2,1H3,(H,14,15) |
CAS-szám | 111-56-8 |
EINECS | 203-882-7 |
Molekuláris szerkezete | |
Sűrűség | 1.189g/cm3 |
Olvadáspont | 30-32℃ |
Forráspont | 344.8°C at 760 mmHg |
Törésmutató | 1.481 |
Gyulladáspont | 162.3°C |
Gőznyomás | 1.15E-05mmHg at 25°C |
Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
MSDS |