ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,4-Cyclohexanedimethanol, mixture of cisand trans |
|
termék neve | 1,4-Cyclohexanedimethanol, mixture of cisand trans |
Angol név | 1,4-Cyclohexanedimethanol, mixture of cisand trans;1,4-Bis(hydroxymethyl)cyclohexane;cyclohex-1,4-ylenedimethanol;1,4-Cyclohexane dimethanol;cyclohexane-1,4-diyldimethanol;1,4-Cyclohexanedimethanol;CHDM |
MF | C8H16O2 |
Molekulatömeg | 144.2114 |
InChI | InChI=1/C8H16O2/c9-5-7-1-2-8(6-10)4-3-7/h7-10H,1-6H2 |
CAS-szám | 105-08-8 |
EINECS | 203-268-9 |
Molekuláris szerkezete | |
Sűrűség | 1.004g/cm3 |
Olvadáspont | 31.5℃ |
Forráspont | 286.2°C at 760 mmHg |
Törésmutató | 1.47 |
Gyulladáspont | 161.1°C |
Vízben való oldhatóság | miscible |
Gőznyomás | 0.000303mmHg at 25°C |
Kockázatot kódok | R36:; |
Biztonsági Leírás | S26||S39:; |
MSDS |