ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
102-85-2 Tributyl phosphite |
|
termék neve | Tributyl phosphite |
Angol név | Tributyl phosphite;Tri-n-butyl phosphite |
MF | C12H27O3P |
Molekulatömeg | 250.3147 |
InChI | InChI=1/C12H27O3P/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-12H2,1-3H3 |
CAS-szám | 102-85-2 |
EINECS | 203-061-3 |
Molekuláris szerkezete | |
Olvadáspont | -80℃ |
Forráspont | 268.1°C at 760 mmHg |
Gyulladáspont | 121.1°C |
Gőznyomás | 0.013mmHg at 25°C |
Veszély szimbólumok | Xn##Harmful:; |
Kockázatot kódok | R21##Harmful in contact with skin.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |