ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
102-39-6 m-phenylenedioxydi(acetic acid) |
|
termék neve | m-phenylenedioxydi(acetic acid) |
Angol név | m-phenylenedioxydi(acetic acid);Resorcinol-O,O-diacetic acid;1,3-Bis(carboxymethoxy)benzene;Resorcinol-O,O-diacetic acid;2,2'-[benzene-1,3-diylbis(oxy)]diacetic acid |
MF | C10H10O6 |
Molekulatömeg | 226.1828 |
InChI | InChI=1/C10H10O6/c11-9(12)5-15-7-2-1-3-8(4-7)16-6-10(13)14/h1-4H,5-6H2,(H,11,12)(H,13,14) |
CAS-szám | 102-39-6 |
EINECS | 203-027-8 |
Molekuláris szerkezete | |
Sűrűség | 1.416g/cm3 |
Forráspont | 447.4°C at 760 mmHg |
Törésmutató | 1.564 |
Gyulladáspont | 180.4°C |
Gőznyomás | 8.65E-09mmHg at 25°C |
Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |