ChemIndex - Ingyenes kémiai CAS adatbázisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3-Nitroformanilide |
|
termék neve | 3-Nitroformanilide |
Angol név | 3-Nitroformanilide;N-(3-nitrophenyl)formamide |
MF | C7H6N2O3 |
Molekulatömeg | 166.1341 |
InChI | InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
CAS-szám | 102-38-5 |
Molekuláris szerkezete | |
Sűrűség | 1.407g/cm3 |
Forráspont | 368.5°C at 760 mmHg |
Törésmutató | 1.641 |
Gyulladáspont | 176.7°C |
Gőznyomás | 1.27E-05mmHg at 25°C |
Kockázatot kódok | R20/22##Harmful by inhalation and if swallowed.:; |
Biztonsági Leírás | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |