ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94-16-6 4-Aminohippuric acid, sodium salt monohydrate |
|
Ονομασία του προϊόντος | 4-Aminohippuric acid, sodium salt monohydrate |
Αγγλικό όνομα | 4-Aminohippuric acid, sodium salt monohydrate;4-Aminohippuric acid sodium salt hydrate;Sodium 4-aminohippurate hydrate;Aminohippurate Sodium;sodium [(4-aminobenzoyl)amino]acetate |
MF | C9H9N2NaO3 |
Μοριακό βάρος | 216.1691 |
InChI | InChI=1/C9H10N2O3.Na/c10-7-3-1-6(2-4-7)9(14)11-5-8(12)13;/h1-4H,5,10H2,(H,11,14)(H,12,13);/q;+1/p-1 |
CAS ΟΧΙ | 94-16-6 |
EINECS | 202-309-8 |
Μοριακή δομή | |
Σημείο τήξης | 123-125℃ |
Σημείο βρασμού | 517.2°C at 760 mmHg |
Σημείο ανάφλεξης | 266.6°C |
Πίεση ατμών | 1.6E-11mmHg at 25°C |
Περιγραφή της ασφάλειας | S24/25##Avoid contact with skin and eyes.:; |
MSDS |