ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
924-49-2 (±)-4-Amino-3-hydroxybutyric acid |
|
Ονομασία του προϊόντος | (±)-4-Amino-3-hydroxybutyric acid |
Αγγλικό όνομα | (±)-4-Amino-3-hydroxybutyric acid;(±)-gamma-Amino-beta-hydroxybutyric acid;(±)-4-amino-3-hydroxybutyric acid |
MF | C4H9NO3 |
Μοριακό βάρος | 119.12 |
InChI | InChI=1/C4H9NO3/c5-2-3(6)1-4(7)8/h3,6H,1-2,5H2,(H,7,8) |
CAS ΟΧΙ | 924-49-2 |
EINECS | 213-106-9 |
Μοριακή δομή | ![]() |
Σημείο τήξης | 202℃ |
Περιγραφή της ασφάλειας | S24/25##Avoid contact with skin and eyes.:; |
MSDS |