ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
6-Methyl-1,2,3,4-tetrahydroquinoline |
|
Ονομασία του προϊόντος | 6-Methyl-1,2,3,4-tetrahydroquinoline |
Αγγλικό όνομα | 6-Methyl-1,2,3,4-tetrahydroquinoline;1,2,3,4-Tetrahydro-6-methylquinoline;AI3-36188;Civettal;NSC 65606;p-Methyltetrahydroquinoline;Quinoline, 1,2,3,4-tetrahydro-6-methyl- |
MF | C10H13N |
Μοριακό βάρος | 147.2169 |
InChI | InChI=1/C10H13N/c1-8-4-5-10-9(7-8)3-2-6-11-10/h4-5,7,11H,2-3,6H2,1H3 |
CAS ΟΧΙ | 91-61-2 |
EINECS | 202-083-0 |
Μοριακή δομή | |
Πυκνότητα | 0.99g/cm3 |
Σημείο βρασμού | 264.2°C at 760 mmHg |
Δείκτης διάθλασης | 1.539 |
Σημείο ανάφλεξης | 119.1°C |
Πίεση ατμών | 0.00982mmHg at 25°C |
Κινδύνου Κώδικες | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Περιγραφή της ασφάλειας | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |