ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
cinnamyl anthranilate |
|
Ονομασία του προϊόντος | cinnamyl anthranilate |
Αγγλικό όνομα | cinnamyl anthranilate;2-Aminobenzoic acid cinnamyl ester~Cinnamyl anthranilate;3-phenylprop-2-en-1-yl 2-aminobenzoate;(2E)-3-phenylprop-2-en-1-yl 2-aminobenzoate |
MF | C16H15NO2 |
Μοριακό βάρος | 253.2958 |
InChI | InChI=1/C16H15NO2/c17-15-11-5-4-10-14(15)16(18)19-12-6-9-13-7-2-1-3-8-13/h1-11H,12,17H2/b9-6+ |
CAS ΟΧΙ | 87-29-6 |
EINECS | 201-738-8 |
Μοριακή δομή | |
Πυκνότητα | 1.178g/cm3 |
Σημείο βρασμού | 449.1°C at 760 mmHg |
Δείκτης διάθλασης | 1.642 |
Σημείο ανάφλεξης | 269.4°C |
Πίεση ατμών | 2.95E-08mmHg at 25°C |
Περιγραφή της ασφάλειας | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |